C7H10O4 — CID 141316236
4-(propoxymethyl)-1,3-dioxol-2-one (PubChem CID 141316236) has the molecular formula C7H10O4 and a molecular weight of 158.15 g/mol. Its IUPAC name is 4-(propoxymethyl)-1,3-dioxol-2-one.
| Compound Name | 4-(propoxymethyl)-1,3-dioxol-2-one |
|---|---|
| PubChem CID | 141316236 |
| Molecular Formula | C7H10O4 |
| Molecular Weight | 158.15 g/mol |
| Exact Mass | 158.06 |
| IUPAC Name | 4-(propoxymethyl)-1,3-dioxol-2-one |
| SMILES | CCCOCc1coc(=O)o1 |
| InChI | InChI=1S/C7H10O4/c1-2-3-9-4-6-5-10-7(8)11-6/h5H,2-4H2,1H3 |
| InChIKey | CBOKFDMFMFWVKM-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 52.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.15 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|