C33H17Br2NO3 — CID 141318810
4,10-bis(4-bromophenyl)-2-phenylindeno[1,2-f]isoindole-1,3,5-trione (PubChem CID 141318810) has the molecular formula C33H17Br2NO3 and a molecular weight of 635.31 g/mol. Its IUPAC name is 4,10-bis(4-bromophenyl)-2-phenylindeno[1,2-f]isoindole-1,3,5-trione.
| Compound Name | 4,10-bis(4-bromophenyl)-2-phenylindeno[1,2-f]isoindole-1,3,5-trione |
|---|---|
| PubChem CID | 141318810 |
| Molecular Formula | C33H17Br2NO3 |
| Molecular Weight | 635.31 g/mol |
| Exact Mass | 632.96 |
| IUPAC Name | 4,10-bis(4-bromophenyl)-2-phenylindeno[1,2-f]isoindole-1,3,5-trione |
| SMILES | O=c1cccc2cc3c(-c4ccc(Br)cc4)c4c(=O)n(-c5ccccc5)c(=O)c4c(-c4ccc(Br)cc4)c3c1-2 |
| InChI | InChI=1S/C33H17Br2NO3/c34-21-13-9-18(10-14-21)26-24-17-20-5-4-8-25(37)27(20)29(24)28(19-11-15-22(35)16-12-19)31-30(26)32(38)36(33(31)39)23-6-2-1-3-7-23/h1-17H |
| InChIKey | SDQUNRSLMNRGRS-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 56.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.31 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |