C9H11N2O6PS — CID 141320309
phosphono 7-amino-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 141320309) has the molecular formula C9H11N2O6PS and a molecular weight of 306.24 g/mol. Its IUPAC name is phosphono 7-amino-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | phosphono 7-amino-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 141320309 |
| Molecular Formula | C9H11N2O6PS |
| Molecular Weight | 306.24 g/mol |
| Exact Mass | 306.01 |
| IUPAC Name | phosphono 7-amino-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | C=CC1=C(C(=O)OP(=O)(O)O)N2C(=O)C(N)C2SC1 |
| InChI | InChI=1S/C9H11N2O6PS/c1-2-4-3-19-8-5(10)7(12)11(8)6(4)9(13)17-18(14,15)16/h2,5,8H,1,3,10H2,(H2,14,15,16) |
| InChIKey | BJUJCNNWNNYWBK-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 130.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.24 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|