C10H11N3O6S — CID 88819627
(6R,7R)-7-amino-3-[(E)-carboxymethoxyiminomethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 88819627) has the molecular formula C10H11N3O6S and a molecular weight of 301.28 g/mol. Its IUPAC name is (6R,7R)-7-amino-3-[(E)-carboxymethoxyiminomethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R,7R)-7-amino-3-[(E)-carboxymethoxyiminomethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 88819627 |
| Molecular Formula | C10H11N3O6S |
| Molecular Weight | 301.28 g/mol |
| Exact Mass | 301.04 |
| IUPAC Name | (6R,7R)-7-amino-3-[(E)-carboxymethoxyiminomethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | N[C@@H]1C(=O)N2C(C(=O)O)=C(/C=N/OCC(=O)O)CS[C@H]12 |
| InChI | InChI=1S/C10H11N3O6S/c11-6-8(16)13-7(10(17)18)4(3-20-9(6)13)1-12-19-2-5(14)15/h1,6,9H,2-3,11H2,(H,14,15)(H,17,18)/b12-1+/t6-,9-/m1/s1 |
| InChIKey | GMZPISUJJXZKEM-CHIAEEADSA-N |
| XLogP | -1.35 |
| TPSA | 142.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.28 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|