C14H20N4O5S — CID 154411260
(6R)-7-amino-3-(2-morpholin-4-ylethoxyiminomethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 154411260) has the molecular formula C14H20N4O5S and a molecular weight of 356.40 g/mol. Its IUPAC name is (6R)-7-amino-3-(2-morpholin-4-ylethoxyiminomethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R)-7-amino-3-(2-morpholin-4-ylethoxyiminomethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 154411260 |
| Molecular Formula | C14H20N4O5S |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | (6R)-7-amino-3-(2-morpholin-4-ylethoxyiminomethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | NC1C(=O)N2C(C(=O)O)=C(C=NOCCN3CCOCC3)CS[C@H]12 |
| InChI | InChI=1S/C14H20N4O5S/c15-10-12(19)18-11(14(20)21)9(8-24-13(10)18)7-16-23-6-3-17-1-4-22-5-2-17/h7,10,13H,1-6,8,15H2,(H,20,21)/t10?,13-/m1/s1 |
| InChIKey | MRCCCUMBDOIDDC-JLOHTSLTSA-N |
| XLogP | -1.10 |
| TPSA | 117.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|