C10H9N3O4S — CID 88820209
(6S,7R)-7-amino-3-(ethynoxyiminomethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 88820209) has the molecular formula C10H9N3O4S and a molecular weight of 267.27 g/mol. Its IUPAC name is (6S,7R)-7-amino-3-(ethynoxyiminomethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6S,7R)-7-amino-3-(ethynoxyiminomethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 88820209 |
| Molecular Formula | C10H9N3O4S |
| Molecular Weight | 267.27 g/mol |
| Exact Mass | 267.03 |
| IUPAC Name | (6S,7R)-7-amino-3-(ethynoxyiminomethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | C#CON=CC1=C(C(=O)O)N2C(=O)[C@@H](N)[C@@H]2SC1 |
| InChI | InChI=1S/C10H9N3O4S/c1-2-17-12-3-5-4-18-9-6(11)8(14)13(9)7(5)10(15)16/h1,3,6,9H,4,11H2,(H,15,16)/t6-,9+/m1/s1 |
| InChIKey | AJXYTJVIHCOJCF-MUWHJKNJSA-N |
| XLogP | -0.84 |
| TPSA | 105.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.27 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|