C14H5IN2O2 — CID 141320841
5-iodo-2,9-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,4,6,8,11,13,15-heptaene-3,10-dione (PubChem CID 141320841) has the molecular formula C14H5IN2O2 and a molecular weight of 360.11 g/mol. Its IUPAC name is 5-iodo-2,9-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,4,6,8,11,13,15-heptaene-3,10-dione.
| Compound Name | 5-iodo-2,9-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,4,6,8,11,13,15-heptaene-3,10-dione |
|---|---|
| PubChem CID | 141320841 |
| Molecular Formula | C14H5IN2O2 |
| Molecular Weight | 360.11 g/mol |
| Exact Mass | 359.94 |
| IUPAC Name | 5-iodo-2,9-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,4,6,8,11,13,15-heptaene-3,10-dione |
| SMILES | O=c1nc2ccc(I)c3c(=O)nc4cccc1c4=c23 |
| InChI | InChI=1S/C14H5IN2O2/c15-7-4-5-9-12-10-6(13(18)16-9)2-1-3-8(10)17-14(19)11(7)12/h1-5H |
| InChIKey | LCKJVRVXYDBOTA-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.11 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|