C14H4I2N2O2 — CID 141320844
6,13-diiodo-2,9-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,4,6,8,11,13,15-heptaene-3,10-dione (PubChem CID 141320844) has the molecular formula C14H4I2N2O2 and a molecular weight of 486.01 g/mol. Its IUPAC name is 6,13-diiodo-2,9-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,4,6,8,11,13,15-heptaene-3,10-dione.
| Compound Name | 6,13-diiodo-2,9-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,4,6,8,11,13,15-heptaene-3,10-dione |
|---|---|
| PubChem CID | 141320844 |
| Molecular Formula | C14H4I2N2O2 |
| Molecular Weight | 486.01 g/mol |
| Exact Mass | 485.84 |
| IUPAC Name | 6,13-diiodo-2,9-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,4,6,8,11,13,15-heptaene-3,10-dione |
| SMILES | O=c1nc2cc(I)cc3c(=O)nc4cc(I)cc1c4=c23 |
| InChI | InChI=1S/C14H4I2N2O2/c15-5-1-7-11-9(3-5)18-14(20)8-2-6(16)4-10(12(8)11)17-13(7)19/h1-4H |
| InChIKey | NBBYWKCHBVWVJA-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.01 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|