C14H6N2O2 — CID 85436629
2,9-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,4,6,8,11,13,15-heptaene-3,10-dione (PubChem CID 85436629) has the molecular formula C14H6N2O2 and a molecular weight of 234.21 g/mol. Its IUPAC name is 2,9-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,4,6,8,11,13,15-heptaene-3,10-dione.
| Compound Name | 2,9-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,4,6,8,11,13,15-heptaene-3,10-dione |
|---|---|
| PubChem CID | 85436629 |
| Molecular Formula | C14H6N2O2 |
| Molecular Weight | 234.21 g/mol |
| Exact Mass | 234.04 |
| IUPAC Name | 2,9-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,4,6,8,11,13,15-heptaene-3,10-dione |
| SMILES | O=c1nc2cccc3c(=O)nc4cccc1c4=c23 |
| InChI | InChI=1S/C14H6N2O2/c17-13-7-3-1-5-9-11(7)12-8(14(18)15-9)4-2-6-10(12)16-13/h1-6H |
| InChIKey | OEMYZFFUEMRORO-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.21 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |