C21H16O2S — CID 141321570
3-[(Z)-2-methyl-3-oxo-1,3-diphenylprop-1-enyl]thiophene-2-carbaldehyde (PubChem CID 141321570) has the molecular formula C21H16O2S and a molecular weight of 332.42 g/mol. Its IUPAC name is 3-[(Z)-2-methyl-3-oxo-1,3-diphenylprop-1-enyl]thiophene-2-carbaldehyde.
| Compound Name | 3-[(Z)-2-methyl-3-oxo-1,3-diphenylprop-1-enyl]thiophene-2-carbaldehyde |
|---|---|
| PubChem CID | 141321570 |
| Molecular Formula | C21H16O2S |
| Molecular Weight | 332.42 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | 3-[(Z)-2-methyl-3-oxo-1,3-diphenylprop-1-enyl]thiophene-2-carbaldehyde |
| SMILES | C/C(C(=O)c1ccccc1)=C(\c1ccccc1)c1ccsc1C=O |
| InChI | InChI=1S/C21H16O2S/c1-15(21(23)17-10-6-3-7-11-17)20(16-8-4-2-5-9-16)18-12-13-24-19(18)14-22/h2-14H,1H3/b20-15- |
| InChIKey | YJFLISHJRVFXTB-HKWRFOASSA-N |
| XLogP | 5.27 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.42 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|