C20H18F2N6O2S — CID 141322738
2-fluoro-1-[4-fluoro-3-[2-(7H-purin-6-yl)anilino]phenyl]propane-1-sulfonamide (PubChem CID 141322738) has the molecular formula C20H18F2N6O2S and a molecular weight of 444.47 g/mol. Its IUPAC name is 2-fluoro-1-[4-fluoro-3-[2-(7H-purin-6-yl)anilino]phenyl]propane-1-sulfonamide.
| Compound Name | 2-fluoro-1-[4-fluoro-3-[2-(7H-purin-6-yl)anilino]phenyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 141322738 |
| Molecular Formula | C20H18F2N6O2S |
| Molecular Weight | 444.47 g/mol |
| Exact Mass | 444.12 |
| IUPAC Name | 2-fluoro-1-[4-fluoro-3-[2-(7H-purin-6-yl)anilino]phenyl]propane-1-sulfonamide |
| SMILES | CC(F)C(c1ccc(F)c(Nc2ccccc2-c2ncnc3nc[nH]c23)c1)S(N)(=O)=O |
| InChI | InChI=1S/C20H18F2N6O2S/c1-11(21)19(31(23,29)30)12-6-7-14(22)16(8-12)28-15-5-3-2-4-13(15)17-18-20(26-9-24-17)27-10-25-18/h2-11,19,28H,1H3,(H2,23,29,30)(H,24,25,26,27) |
| InChIKey | JNQDZODXKOZSMD-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 126.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.47 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |