C22H21BrClNO — CID 141325095
3-(4-bromophenyl)-3-(4-chloro-2-methylphenyl)-1-(1-methyl-2H-pyridin-5-yl)propan-1-one (PubChem CID 141325095) has the molecular formula C22H21BrClNO and a molecular weight of 430.77 g/mol. Its IUPAC name is 3-(4-bromophenyl)-3-(4-chloro-2-methylphenyl)-1-(1-methyl-2H-pyridin-5-yl)propan-1-one.
| Compound Name | 3-(4-bromophenyl)-3-(4-chloro-2-methylphenyl)-1-(1-methyl-2H-pyridin-5-yl)propan-1-one |
|---|---|
| PubChem CID | 141325095 |
| Molecular Formula | C22H21BrClNO |
| Molecular Weight | 430.77 g/mol |
| Exact Mass | 429.05 |
| IUPAC Name | 3-(4-bromophenyl)-3-(4-chloro-2-methylphenyl)-1-(1-methyl-2H-pyridin-5-yl)propan-1-one |
| SMILES | Cc1cc(Cl)ccc1C(CC(=O)C1=CN(C)CC=C1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C22H21BrClNO/c1-15-12-19(24)9-10-20(15)21(16-5-7-18(23)8-6-16)13-22(26)17-4-3-11-25(2)14-17/h3-10,12,14,21H,11,13H2,1-2H3 |
| InChIKey | UQXQYLSUOPIBSK-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.77 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |