C23H22FNO2 — CID 141325835
tert-butyl 3-(2-cyclopropyl-4-fluorophenyl)quinoline-2-carboxylate (PubChem CID 141325835) has the molecular formula C23H22FNO2 and a molecular weight of 363.43 g/mol. Its IUPAC name is tert-butyl 3-(2-cyclopropyl-4-fluorophenyl)quinoline-2-carboxylate.
| Compound Name | tert-butyl 3-(2-cyclopropyl-4-fluorophenyl)quinoline-2-carboxylate |
|---|---|
| PubChem CID | 141325835 |
| Molecular Formula | C23H22FNO2 |
| Molecular Weight | 363.43 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | tert-butyl 3-(2-cyclopropyl-4-fluorophenyl)quinoline-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)c1nc2ccccc2cc1-c1ccc(F)cc1C1CC1 |
| InChI | InChI=1S/C23H22FNO2/c1-23(2,3)27-22(26)21-19(12-15-6-4-5-7-20(15)25-21)17-11-10-16(24)13-18(17)14-8-9-14/h4-7,10-14H,8-9H2,1-3H3 |
| InChIKey | BKRCYCDLFNXGMI-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.43 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |