C23H28FNO3 — CID 139512745
tert-butyl 1-[4-(6-fluoroquinolin-4-yl)-1-hydroxycyclohexyl]cyclopropane-1-carboxylate (PubChem CID 139512745) has the molecular formula C23H28FNO3 and a molecular weight of 385.48 g/mol. Its IUPAC name is tert-butyl 1-[4-(6-fluoroquinolin-4-yl)-1-hydroxycyclohexyl]cyclopropane-1-carboxylate.
| Compound Name | tert-butyl 1-[4-(6-fluoroquinolin-4-yl)-1-hydroxycyclohexyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 139512745 |
| Molecular Formula | C23H28FNO3 |
| Molecular Weight | 385.48 g/mol |
| Exact Mass | 385.21 |
| IUPAC Name | tert-butyl 1-[4-(6-fluoroquinolin-4-yl)-1-hydroxycyclohexyl]cyclopropane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1(C2(O)CCC(c3ccnc4ccc(F)cc34)CC2)CC1 |
| InChI | InChI=1S/C23H28FNO3/c1-21(2,3)28-20(26)22(11-12-22)23(27)9-6-15(7-10-23)17-8-13-25-19-5-4-16(24)14-18(17)19/h4-5,8,13-15,27H,6-7,9-12H2,1-3H3 |
| InChIKey | FIDABRGGLSLXQH-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.48 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |