C20H24FNO4 — CID 155221481
ethyl 2-[4-(6-fluoroquinolin-4-yl)-1-hydroxycyclohexyl]-3-hydroxypropanoate (PubChem CID 155221481) has the molecular formula C20H24FNO4 and a molecular weight of 361.41 g/mol. Its IUPAC name is ethyl 2-[4-(6-fluoroquinolin-4-yl)-1-hydroxycyclohexyl]-3-hydroxypropanoate.
| Compound Name | ethyl 2-[4-(6-fluoroquinolin-4-yl)-1-hydroxycyclohexyl]-3-hydroxypropanoate |
|---|---|
| PubChem CID | 155221481 |
| Molecular Formula | C20H24FNO4 |
| Molecular Weight | 361.41 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | ethyl 2-[4-(6-fluoroquinolin-4-yl)-1-hydroxycyclohexyl]-3-hydroxypropanoate |
| SMILES | CCOC(=O)C(CO)C1(O)CCC(c2ccnc3ccc(F)cc23)CC1 |
| InChI | InChI=1S/C20H24FNO4/c1-2-26-19(24)17(12-23)20(25)8-5-13(6-9-20)15-7-10-22-18-4-3-14(21)11-16(15)18/h3-4,7,10-11,13,17,23,25H,2,5-6,8-9,12H2,1H3 |
| InChIKey | GMUMBWHCCPGZGH-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 79.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.41 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |