C18H18FNO3 — CID 155087986
ethyl 2-[(1R,2S)-2-(6-fluoroquinolin-4-yl)cyclopentyl]-2-oxoacetate (PubChem CID 155087986) has the molecular formula C18H18FNO3 and a molecular weight of 315.34 g/mol. Its IUPAC name is ethyl 2-[(1R,2S)-2-(6-fluoroquinolin-4-yl)cyclopentyl]-2-oxoacetate.
| Compound Name | ethyl 2-[(1R,2S)-2-(6-fluoroquinolin-4-yl)cyclopentyl]-2-oxoacetate |
|---|---|
| PubChem CID | 155087986 |
| Molecular Formula | C18H18FNO3 |
| Molecular Weight | 315.34 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | ethyl 2-[(1R,2S)-2-(6-fluoroquinolin-4-yl)cyclopentyl]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)[C@@H]1CCC[C@@H]1c1ccnc2ccc(F)cc12 |
| InChI | InChI=1S/C18H18FNO3/c1-2-23-18(22)17(21)14-5-3-4-12(14)13-8-9-20-16-7-6-11(19)10-15(13)16/h6-10,12,14H,2-5H2,1H3/t12-,14-/m1/s1 |
| InChIKey | FPUJFZUHZFSTPW-TZMCWYRMSA-N |
| XLogP | 3.39 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.34 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|