C23H30FNO4 — CID 146470824
ethyl 3-[(3S)-3-(6-fluoroquinolin-4-yl)cyclohexyl]-3-(2-methoxyethoxy)propanoate (PubChem CID 146470824) has the molecular formula C23H30FNO4 and a molecular weight of 403.49 g/mol. Its IUPAC name is ethyl 3-[(3S)-3-(6-fluoroquinolin-4-yl)cyclohexyl]-3-(2-methoxyethoxy)propanoate.
| Compound Name | ethyl 3-[(3S)-3-(6-fluoroquinolin-4-yl)cyclohexyl]-3-(2-methoxyethoxy)propanoate |
|---|---|
| PubChem CID | 146470824 |
| Molecular Formula | C23H30FNO4 |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.22 |
| IUPAC Name | ethyl 3-[(3S)-3-(6-fluoroquinolin-4-yl)cyclohexyl]-3-(2-methoxyethoxy)propanoate |
| SMILES | CCOC(=O)CC(OCCOC)C1CCC[C@H](c2ccnc3ccc(F)cc23)C1 |
| InChI | InChI=1S/C23H30FNO4/c1-3-28-23(26)15-22(29-12-11-27-2)17-6-4-5-16(13-17)19-9-10-25-21-8-7-18(24)14-20(19)21/h7-10,14,16-17,22H,3-6,11-13,15H2,1-2H3/t16-,17?,22?/m0/s1 |
| InChIKey | BIHKCBZNZPDFJN-YPHUNTSASA-N |
| XLogP | 4.63 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|