C36H75AlO3 — CID 141326405
tris(3,4-diethyloctan-3-yloxy)alumane (PubChem CID 141326405) has the molecular formula C36H75AlO3 and a molecular weight of 582.98 g/mol. Its IUPAC name is tris(3,4-diethyloctan-3-yloxy)alumane.
| Compound Name | tris(3,4-diethyloctan-3-yloxy)alumane |
|---|---|
| PubChem CID | 141326405 |
| Molecular Formula | C36H75AlO3 |
| Molecular Weight | 582.98 g/mol |
| Exact Mass | 582.55 |
| IUPAC Name | tris(3,4-diethyloctan-3-yloxy)alumane |
| SMILES | CCCCC(CC)C(CC)(CC)O[Al](OC(CC)(CC)C(CC)CCCC)OC(CC)(CC)C(CC)CCCC |
| InChI | InChI=1S/3C12H25O.Al/c3*1-5-9-10-11(6-2)12(13,7-3)8-4;/h3*11H,5-10H2,1-4H3;/q3*-1;+3 |
| InChIKey | QNKVAASEVFIBOA-UHFFFAOYSA-N |
| XLogP | 12.35 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.98 |
| LogP ≤ 5 | 12.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |