C22H49P3 — CID 90111416
[3,4-diethyl-2-(4-ethyl-3-phosphanyloctan-3-yl)-2-phosphanyloctan-3-yl]phosphane (PubChem CID 90111416) has the molecular formula C22H49P3 and a molecular weight of 406.56 g/mol. Its IUPAC name is [3,4-diethyl-2-(4-ethyl-3-phosphanyloctan-3-yl)-2-phosphanyloctan-3-yl]phosphane.
| Compound Name | [3,4-diethyl-2-(4-ethyl-3-phosphanyloctan-3-yl)-2-phosphanyloctan-3-yl]phosphane |
|---|---|
| PubChem CID | 90111416 |
| Molecular Formula | C22H49P3 |
| Molecular Weight | 406.56 g/mol |
| Exact Mass | 406.30 |
| IUPAC Name | [3,4-diethyl-2-(4-ethyl-3-phosphanyloctan-3-yl)-2-phosphanyloctan-3-yl]phosphane |
| SMILES | CCCCC(CC)C(P)(CC)C(C)(P)C(P)(CC)C(CC)CCCC |
| InChI | InChI=1S/C22H49P3/c1-8-14-16-18(10-3)21(24,12-5)20(7,23)22(25,13-6)19(11-4)17-15-9-2/h18-19H,8-17,23-25H2,1-7H3 |
| InChIKey | NQEJSALGSJXCKW-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.56 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|