C17H38IP — CID 173158517
3,4-diethyltridecan-3-ylphosphane;hydroiodide (PubChem CID 173158517) has the molecular formula C17H38IP and a molecular weight of 400.37 g/mol. Its IUPAC name is 3,4-diethyltridecan-3-ylphosphane;hydroiodide.
| Compound Name | 3,4-diethyltridecan-3-ylphosphane;hydroiodide |
|---|---|
| PubChem CID | 173158517 |
| Molecular Formula | C17H38IP |
| Molecular Weight | 400.37 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | 3,4-diethyltridecan-3-ylphosphane;hydroiodide |
| SMILES | CCCCCCCCCC(CC)C(P)(CC)CC.I |
| InChI | InChI=1S/C17H37P.HI/c1-5-9-10-11-12-13-14-15-16(6-2)17(18,7-3)8-4;/h16H,5-15,18H2,1-4H3;1H |
| InChIKey | YVIKRDNUGZJGEC-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.37 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|