C15H35O3PS — CID 173110597
3,4-diethyldecan-3-ylphosphane;methanesulfonic acid (PubChem CID 173110597) has the molecular formula C15H35O3PS and a molecular weight of 326.48 g/mol. Its IUPAC name is 3,4-diethyldecan-3-ylphosphane;methanesulfonic acid.
| Compound Name | 3,4-diethyldecan-3-ylphosphane;methanesulfonic acid |
|---|---|
| PubChem CID | 173110597 |
| Molecular Formula | C15H35O3PS |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | 3,4-diethyldecan-3-ylphosphane;methanesulfonic acid |
| SMILES | CCCCCCC(CC)C(P)(CC)CC.CS(=O)(=O)O |
| InChI | InChI=1S/C14H31P.CH4O3S/c1-5-9-10-11-12-13(6-2)14(15,7-3)8-4;1-5(2,3)4/h13H,5-12,15H2,1-4H3;1H3,(H,2,3,4) |
| InChIKey | PODORCCCAWWGHV-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|