C9H9BrN2 — CID 141326782
3-bromo-2-methyl-4H-pyrido[1,2-a]pyrimidine (PubChem CID 141326782) has the molecular formula C9H9BrN2 and a molecular weight of 225.09 g/mol. Its IUPAC name is 3-bromo-2-methyl-4H-pyrido[1,2-a]pyrimidine.
| Compound Name | 3-bromo-2-methyl-4H-pyrido[1,2-a]pyrimidine |
|---|---|
| PubChem CID | 141326782 |
| Molecular Formula | C9H9BrN2 |
| Molecular Weight | 225.09 g/mol |
| Exact Mass | 223.99 |
| IUPAC Name | 3-bromo-2-methyl-4H-pyrido[1,2-a]pyrimidine |
| SMILES | CC1=C(Br)CN2C=CC=CC2=N1 |
| InChI | InChI=1S/C9H9BrN2/c1-7-8(10)6-12-5-3-2-4-9(12)11-7/h2-5H,6H2,1H3 |
| InChIKey | TYXDJGMAHRVGCE-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.09 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |