About 3-ethyl-3-[1,1,1-tris[(3-ethyloxetan-3-yl)methoxy]pentan-2-yloxymethyl]oxetane
3-ethyl-3-[1,1,1-tris[(3-ethyloxetan-3-yl)methoxy]pentan-2-yloxymethyl]oxetane (PubChem CID 141327303) has the molecular formula C29H52O8
and a molecular weight of 528.73 g/mol. Its IUPAC name is 3-ethyl-3-[1,1,1-tris[(3-ethyloxetan-3-yl)methoxy]pentan-2-yloxymethyl]oxetane.
Molecular Properties
| Compound Name | 3-ethyl-3-[1,1,1-tris[(3-ethyloxetan-3-yl)methoxy]pentan-2-yloxymethyl]oxetane |
| PubChem CID | 141327303 |
| Molecular Formula | C29H52O8 |
| Molecular Weight | 528.73 g/mol |
| Exact Mass | 528.37 |
| IUPAC Name | 3-ethyl-3-[1,1,1-tris[(3-ethyloxetan-3-yl)methoxy]pentan-2-yloxymethyl]oxetane |
| SMILES | CCCC(OCC1(CC)COC1)C(OCC1(CC)COC1)(OCC1(CC)COC1)OCC1(CC)COC1 |
| InChI | InChI=1S/C29H52O8/c1-6-11-24(34-20-25(7-2)12-30-13-25)29(35-21-26(8-3)14-31-15-26,36-22-27(9-4)16-32-17-27)37-23-28(10-5)18-33-19-28/h24H,6-23H2,1-5H3 |
| InChIKey | VYXUIXPHAUTNAB-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 528.73 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyl-3-[1,1,1-tris[(3-ethyloxetan-3-yl)methoxy]pentan-2-yloxymethyl]oxetane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-3-[1,1,1-tris[(3-ethyloxetan-3-yl)methoxy]pentan-2-yloxymethyl]oxetane?
The IUPAC name of 3-ethyl-3-[1,1,1-tris[(3-ethyloxetan-3-yl)methoxy]pentan-2-yloxymethyl]oxetane (CID 141327303) is 3-ethyl-3-[1,1,1-tris[(3-ethyloxetan-3-yl)methoxy]pentan-2-yloxymethyl]oxetane.
What is the SMILES notation for 3-ethyl-3-[1,1,1-tris[(3-ethyloxetan-3-yl)methoxy]pentan-2-yloxymethyl]oxetane?
The canonical SMILES for 3-ethyl-3-[1,1,1-tris[(3-ethyloxetan-3-yl)methoxy]pentan-2-yloxymethyl]oxetane is CCCC(OCC1(CC)COC1)C(OCC1(CC)COC1)(OCC1(CC)COC1)OCC1(CC)COC1.
What is the InChIKey of 3-ethyl-3-[1,1,1-tris[(3-ethyloxetan-3-yl)methoxy]pentan-2-yloxymethyl]oxetane?
The InChIKey is VYXUIXPHAUTNAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H52O8/c1-6-11-24(34-20-25(7-2)12-30-13-25)29(35-21-26(8-3)14-31-15-26,36-22-27(9-4)16-32-17-27)37-23-28(10-5)18-33-19-28/h24H,6-23H2,1-5H3.
What are the key properties of 3-ethyl-3-[1,1,1-tris[(3-ethyloxetan-3-yl)methoxy]pentan-2-yloxymethyl]oxetane?
3-ethyl-3-[1,1,1-tris[(3-ethyloxetan-3-yl)methoxy]pentan-2-yloxymethyl]oxetane has a molecular weight of 528.73 g/mol, XLogP of 4.58, 19 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-3-[1,1,1-tris[(3-ethyloxetan-3-yl)methoxy]pentan-2-yloxymethyl]oxetane is sourced from PubChem (CID 141327303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).