C17H20FN3O4 — CID 141328371
amino 3-fluoro-4-hydroxy-2-[(6-methoxyquinolin-4-yl)methyl]piperidine-1-carboxylate (PubChem CID 141328371) has the molecular formula C17H20FN3O4 and a molecular weight of 349.36 g/mol. Its IUPAC name is amino 3-fluoro-4-hydroxy-2-[(6-methoxyquinolin-4-yl)methyl]piperidine-1-carboxylate.
| Compound Name | amino 3-fluoro-4-hydroxy-2-[(6-methoxyquinolin-4-yl)methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 141328371 |
| Molecular Formula | C17H20FN3O4 |
| Molecular Weight | 349.36 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | amino 3-fluoro-4-hydroxy-2-[(6-methoxyquinolin-4-yl)methyl]piperidine-1-carboxylate |
| SMILES | COc1ccc2nccc(CC3C(F)C(O)CCN3C(=O)ON)c2c1 |
| InChI | InChI=1S/C17H20FN3O4/c1-24-11-2-3-13-12(9-11)10(4-6-20-13)8-14-16(18)15(22)5-7-21(14)17(23)25-19/h2-4,6,9,14-16,22H,5,7-8,19H2,1H3 |
| InChIKey | QIQBBDSUEIDYQM-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 97.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.36 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|