C26H29NO9S — CID 141329586
methyl 2-[[2-acetyloxy-3-(3,4-diacetyloxyphenyl)propanoyl]amino]-2-benzylsulfanylpropanoate (PubChem CID 141329586) has the molecular formula C26H29NO9S and a molecular weight of 531.58 g/mol. Its IUPAC name is methyl 2-[[2-acetyloxy-3-(3,4-diacetyloxyphenyl)propanoyl]amino]-2-benzylsulfanylpropanoate.
| Compound Name | methyl 2-[[2-acetyloxy-3-(3,4-diacetyloxyphenyl)propanoyl]amino]-2-benzylsulfanylpropanoate |
|---|---|
| PubChem CID | 141329586 |
| Molecular Formula | C26H29NO9S |
| Molecular Weight | 531.58 g/mol |
| Exact Mass | 531.16 |
| IUPAC Name | methyl 2-[[2-acetyloxy-3-(3,4-diacetyloxyphenyl)propanoyl]amino]-2-benzylsulfanylpropanoate |
| SMILES | COC(=O)C(C)(NC(=O)C(Cc1ccc(OC(C)=O)c(OC(C)=O)c1)OC(C)=O)SCc1ccccc1 |
| InChI | InChI=1S/C26H29NO9S/c1-16(28)34-21-12-11-20(13-22(21)35-17(2)29)14-23(36-18(3)30)24(31)27-26(4,25(32)33-5)37-15-19-9-7-6-8-10-19/h6-13,23H,14-15H2,1-5H3,(H,27,31) |
| InChIKey | HMANOONZFKGDSK-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 134.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.58 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|