C17H23N3O2 — CID 141329791
tert-butyl N-[[4-[5-(methylamino)-1H-pyrrol-3-yl]phenyl]methyl]carbamate (PubChem CID 141329791) has the molecular formula C17H23N3O2 and a molecular weight of 301.39 g/mol. Its IUPAC name is tert-butyl N-[[4-[5-(methylamino)-1H-pyrrol-3-yl]phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[4-[5-(methylamino)-1H-pyrrol-3-yl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 141329791 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | tert-butyl N-[[4-[5-(methylamino)-1H-pyrrol-3-yl]phenyl]methyl]carbamate |
| SMILES | CNc1cc(-c2ccc(CNC(=O)OC(C)(C)C)cc2)c[nH]1 |
| InChI | InChI=1S/C17H23N3O2/c1-17(2,3)22-16(21)20-10-12-5-7-13(8-6-12)14-9-15(18-4)19-11-14/h5-9,11,18-19H,10H2,1-4H3,(H,20,21) |
| InChIKey | CVMZXMIWLVOOJA-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |