C11H14F3N3 — CID 141330185
1-(1H-pyrazol-5-yl)-4-(3,3,3-trifluoropropylidene)piperidine (PubChem CID 141330185) has the molecular formula C11H14F3N3 and a molecular weight of 245.25 g/mol. Its IUPAC name is 1-(1H-pyrazol-5-yl)-4-(3,3,3-trifluoropropylidene)piperidine.
| Compound Name | 1-(1H-pyrazol-5-yl)-4-(3,3,3-trifluoropropylidene)piperidine |
|---|---|
| PubChem CID | 141330185 |
| Molecular Formula | C11H14F3N3 |
| Molecular Weight | 245.25 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | 1-(1H-pyrazol-5-yl)-4-(3,3,3-trifluoropropylidene)piperidine |
| SMILES | FC(F)(F)CC=C1CCN(c2ccn[nH]2)CC1 |
| InChI | InChI=1S/C11H14F3N3/c12-11(13,14)5-1-9-3-7-17(8-4-9)10-2-6-15-16-10/h1-2,6H,3-5,7-8H2,(H,15,16) |
| InChIKey | NUGSFSPAYLHOAC-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.25 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|