C13H16O4 — CID 141330437
(E)-6,6-dihydroxy-1-(4-methoxyphenyl)hex-2-en-1-one (PubChem CID 141330437) has the molecular formula C13H16O4 and a molecular weight of 236.27 g/mol. Its IUPAC name is (E)-6,6-dihydroxy-1-(4-methoxyphenyl)hex-2-en-1-one.
| Compound Name | (E)-6,6-dihydroxy-1-(4-methoxyphenyl)hex-2-en-1-one |
|---|---|
| PubChem CID | 141330437 |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | (E)-6,6-dihydroxy-1-(4-methoxyphenyl)hex-2-en-1-one |
| SMILES | COc1ccc(C(=O)/C=C/CCC(O)O)cc1 |
| InChI | InChI=1S/C13H16O4/c1-17-11-8-6-10(7-9-11)12(14)4-2-3-5-13(15)16/h2,4,6-9,13,15-16H,3,5H2,1H3/b4-2+ |
| InChIKey | YQVHPNHFHWQGDI-DUXPYHPUSA-N |
| XLogP | 1.52 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|