C11H18N2O2S — CID 141330978
1-(3-ethoxypropyl)-2-sulfanyl-2H-pyridine-3-carboxamide (PubChem CID 141330978) has the molecular formula C11H18N2O2S and a molecular weight of 242.34 g/mol. Its IUPAC name is 1-(3-ethoxypropyl)-2-sulfanyl-2H-pyridine-3-carboxamide.
| Compound Name | 1-(3-ethoxypropyl)-2-sulfanyl-2H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 141330978 |
| Molecular Formula | C11H18N2O2S |
| Molecular Weight | 242.34 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 1-(3-ethoxypropyl)-2-sulfanyl-2H-pyridine-3-carboxamide |
| SMILES | CCOCCCN1C=CC=C(C(N)=O)C1S |
| InChI | InChI=1S/C11H18N2O2S/c1-2-15-8-4-7-13-6-3-5-9(10(12)14)11(13)16/h3,5-6,11,16H,2,4,7-8H2,1H3,(H2,12,14) |
| InChIKey | UQHGMBHFRZNKKP-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.34 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|