C8H12N2O2S — CID 141330983
1-(2-hydroxyethyl)-2-sulfanyl-2H-pyridine-3-carboxamide (PubChem CID 141330983) has the molecular formula C8H12N2O2S and a molecular weight of 200.26 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-2-sulfanyl-2H-pyridine-3-carboxamide.
| Compound Name | 1-(2-hydroxyethyl)-2-sulfanyl-2H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 141330983 |
| Molecular Formula | C8H12N2O2S |
| Molecular Weight | 200.26 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | 1-(2-hydroxyethyl)-2-sulfanyl-2H-pyridine-3-carboxamide |
| SMILES | NC(=O)C1=CC=CN(CCO)C1S |
| InChI | InChI=1S/C8H12N2O2S/c9-7(12)6-2-1-3-10(4-5-11)8(6)13/h1-3,8,11,13H,4-5H2,(H2,9,12) |
| InChIKey | WDJUAUKNCAERMY-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.26 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|