C10H16N2O3S — CID 141330972
N,N-bis(2-hydroxyethyl)-2-sulfanyl-1,2-dihydropyridine-3-carboxamide (PubChem CID 141330972) has the molecular formula C10H16N2O3S and a molecular weight of 244.32 g/mol. Its IUPAC name is N,N-bis(2-hydroxyethyl)-2-sulfanyl-1,2-dihydropyridine-3-carboxamide.
| Compound Name | N,N-bis(2-hydroxyethyl)-2-sulfanyl-1,2-dihydropyridine-3-carboxamide |
|---|---|
| PubChem CID | 141330972 |
| Molecular Formula | C10H16N2O3S |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | N,N-bis(2-hydroxyethyl)-2-sulfanyl-1,2-dihydropyridine-3-carboxamide |
| SMILES | O=C(C1=CC=CNC1S)N(CCO)CCO |
| InChI | InChI=1S/C10H16N2O3S/c13-6-4-12(5-7-14)10(15)8-2-1-3-11-9(8)16/h1-3,9,11,13-14,16H,4-7H2 |
| InChIKey | BRMMYUAXWMTCHA-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|