C9H14N2O3S — CID 141330969
1-(2,3-dihydroxypropyl)-2-sulfanyl-2H-pyridine-3-carboxamide (PubChem CID 141330969) has the molecular formula C9H14N2O3S and a molecular weight of 230.29 g/mol. Its IUPAC name is 1-(2,3-dihydroxypropyl)-2-sulfanyl-2H-pyridine-3-carboxamide.
| Compound Name | 1-(2,3-dihydroxypropyl)-2-sulfanyl-2H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 141330969 |
| Molecular Formula | C9H14N2O3S |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | 1-(2,3-dihydroxypropyl)-2-sulfanyl-2H-pyridine-3-carboxamide |
| SMILES | NC(=O)C1=CC=CN(CC(O)CO)C1S |
| InChI | InChI=1S/C9H14N2O3S/c10-8(14)7-2-1-3-11(9(7)15)4-6(13)5-12/h1-3,6,9,12-13,15H,4-5H2,(H2,10,14) |
| InChIKey | KQMCASZXCXSFLO-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|