C9H12N2O3S — CID 107017924
1-(2,3-dihydroxypropyl)-2-oxopyridine-3-carbothioamide (PubChem CID 107017924) has the molecular formula C9H12N2O3S and a molecular weight of 228.27 g/mol. Its IUPAC name is 1-(2,3-dihydroxypropyl)-2-oxopyridine-3-carbothioamide.
| Compound Name | 1-(2,3-dihydroxypropyl)-2-oxopyridine-3-carbothioamide |
|---|---|
| PubChem CID | 107017924 |
| Molecular Formula | C9H12N2O3S |
| Molecular Weight | 228.27 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | 1-(2,3-dihydroxypropyl)-2-oxopyridine-3-carbothioamide |
| SMILES | NC(=S)c1cccn(CC(O)CO)c1=O |
| InChI | InChI=1S/C9H12N2O3S/c10-8(15)7-2-1-3-11(9(7)14)4-6(13)5-12/h1-3,6,12-13H,4-5H2,(H2,10,15) |
| InChIKey | BCDGVBBFAWVOEE-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.27 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|