C9H13N3O3S — CID 146490554
1-amino-N-[(2S)-2,3-dihydroxypropyl]-2-sulfanylidenepyridine-3-carboxamide (PubChem CID 146490554) has the molecular formula C9H13N3O3S and a molecular weight of 243.29 g/mol. Its IUPAC name is 1-amino-N-[(2S)-2,3-dihydroxypropyl]-2-sulfanylidenepyridine-3-carboxamide.
| Compound Name | 1-amino-N-[(2S)-2,3-dihydroxypropyl]-2-sulfanylidenepyridine-3-carboxamide |
|---|---|
| PubChem CID | 146490554 |
| Molecular Formula | C9H13N3O3S |
| Molecular Weight | 243.29 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | 1-amino-N-[(2S)-2,3-dihydroxypropyl]-2-sulfanylidenepyridine-3-carboxamide |
| SMILES | Nn1cccc(C(=O)NC[C@H](O)CO)c1=S |
| InChI | InChI=1S/C9H13N3O3S/c10-12-3-1-2-7(9(12)16)8(15)11-4-6(14)5-13/h1-3,6,13-14H,4-5,10H2,(H,11,15)/t6-/m0/s1 |
| InChIKey | YQAARMRVCFWEOW-LURJTMIESA-N |
| XLogP | -0.99 |
| TPSA | 100.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.29 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|