C15H26N2OS — CID 141330989
1-nonyl-2-sulfanyl-2H-pyridine-3-carboxamide (PubChem CID 141330989) has the molecular formula C15H26N2OS and a molecular weight of 282.45 g/mol. Its IUPAC name is 1-nonyl-2-sulfanyl-2H-pyridine-3-carboxamide.
| Compound Name | 1-nonyl-2-sulfanyl-2H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 141330989 |
| Molecular Formula | C15H26N2OS |
| Molecular Weight | 282.45 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | 1-nonyl-2-sulfanyl-2H-pyridine-3-carboxamide |
| SMILES | CCCCCCCCCN1C=CC=C(C(N)=O)C1S |
| InChI | InChI=1S/C15H26N2OS/c1-2-3-4-5-6-7-8-11-17-12-9-10-13(14(16)18)15(17)19/h9-10,12,15,19H,2-8,11H2,1H3,(H2,16,18) |
| InChIKey | XANSXRBTKIWKEQ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.45 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|