C11H16N2OS — CID 141330992
1-cyclopentyl-2-sulfanyl-2H-pyridine-3-carboxamide (PubChem CID 141330992) has the molecular formula C11H16N2OS and a molecular weight of 224.33 g/mol. Its IUPAC name is 1-cyclopentyl-2-sulfanyl-2H-pyridine-3-carboxamide.
| Compound Name | 1-cyclopentyl-2-sulfanyl-2H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 141330992 |
| Molecular Formula | C11H16N2OS |
| Molecular Weight | 224.33 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 1-cyclopentyl-2-sulfanyl-2H-pyridine-3-carboxamide |
| SMILES | NC(=O)C1=CC=CN(C2CCCC2)C1S |
| InChI | InChI=1S/C11H16N2OS/c12-10(14)9-6-3-7-13(11(9)15)8-4-1-2-5-8/h3,6-8,11,15H,1-2,4-5H2,(H2,12,14) |
| InChIKey | WZRGINCASODHEB-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.33 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|