About 7-benzylsulfonyl-2-chloro-N-(4-methoxyphenyl)pyrrolo[2,3-d]pyrimidin-4-amine
7-benzylsulfonyl-2-chloro-N-(4-methoxyphenyl)pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 141331023) has the molecular formula C20H17ClN4O3S
and a molecular weight of 428.90 g/mol. Its IUPAC name is 7-benzylsulfonyl-2-chloro-N-(4-methoxyphenyl)pyrrolo[2,3-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 7-benzylsulfonyl-2-chloro-N-(4-methoxyphenyl)pyrrolo[2,3-d]pyrimidin-4-amine |
| PubChem CID | 141331023 |
| Molecular Formula | C20H17ClN4O3S |
| Molecular Weight | 428.90 g/mol |
| Exact Mass | 428.07 |
| IUPAC Name | 7-benzylsulfonyl-2-chloro-N-(4-methoxyphenyl)pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | COc1ccc(Nc2nc(Cl)nc3c2ccn3S(=O)(=O)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C20H17ClN4O3S/c1-28-16-9-7-15(8-10-16)22-18-17-11-12-25(19(17)24-20(21)23-18)29(26,27)13-14-5-3-2-4-6-14/h2-12H,13H2,1H3,(H,22,23,24) |
| InChIKey | WKWFFWIKADARGY-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.90 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 7-benzylsulfonyl-2-chloro-N-(4-methoxyphenyl)pyrrolo[2,3-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-benzylsulfonyl-2-chloro-N-(4-methoxyphenyl)pyrrolo[2,3-d]pyrimidin-4-amine?
The IUPAC name of 7-benzylsulfonyl-2-chloro-N-(4-methoxyphenyl)pyrrolo[2,3-d]pyrimidin-4-amine (CID 141331023) is 7-benzylsulfonyl-2-chloro-N-(4-methoxyphenyl)pyrrolo[2,3-d]pyrimidin-4-amine.
What is the SMILES notation for 7-benzylsulfonyl-2-chloro-N-(4-methoxyphenyl)pyrrolo[2,3-d]pyrimidin-4-amine?
The canonical SMILES for 7-benzylsulfonyl-2-chloro-N-(4-methoxyphenyl)pyrrolo[2,3-d]pyrimidin-4-amine is COc1ccc(Nc2nc(Cl)nc3c2ccn3S(=O)(=O)Cc2ccccc2)cc1.
What is the InChIKey of 7-benzylsulfonyl-2-chloro-N-(4-methoxyphenyl)pyrrolo[2,3-d]pyrimidin-4-amine?
The InChIKey is WKWFFWIKADARGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17ClN4O3S/c1-28-16-9-7-15(8-10-16)22-18-17-11-12-25(19(17)24-20(21)23-18)29(26,27)13-14-5-3-2-4-6-14/h2-12H,13H2,1H3,(H,22,23,24).
What are the key properties of 7-benzylsulfonyl-2-chloro-N-(4-methoxyphenyl)pyrrolo[2,3-d]pyrimidin-4-amine?
7-benzylsulfonyl-2-chloro-N-(4-methoxyphenyl)pyrrolo[2,3-d]pyrimidin-4-amine has a molecular weight of 428.90 g/mol, XLogP of 4.22, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 7-benzylsulfonyl-2-chloro-N-(4-methoxyphenyl)pyrrolo[2,3-d]pyrimidin-4-amine is sourced from PubChem (CID 141331023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).