C27H38N6O4 — CID 141331316
N-[(2S)-1-[(3aS,6S,6aS)-6-azido-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-4-methyl-1-oxopentan-2-yl]-4-(1-propylpiperidin-4-yl)benzamide (PubChem CID 141331316) has the molecular formula C27H38N6O4 and a molecular weight of 510.64 g/mol. Its IUPAC name is N-[(2S)-1-[(3aS,6S,6aS)-6-azido-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-4-methyl-1-oxopentan-2-yl]-4-(1-propylpiperidin-4-yl)benzamide.
| Compound Name | N-[(2S)-1-[(3aS,6S,6aS)-6-azido-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-4-methyl-1-oxopentan-2-yl]-4-(1-propylpiperidin-4-yl)benzamide |
|---|---|
| PubChem CID | 141331316 |
| Molecular Formula | C27H38N6O4 |
| Molecular Weight | 510.64 g/mol |
| Exact Mass | 510.30 |
| IUPAC Name | N-[(2S)-1-[(3aS,6S,6aS)-6-azido-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-4-methyl-1-oxopentan-2-yl]-4-(1-propylpiperidin-4-yl)benzamide |
| SMILES | CCCN1CCC(c2ccc(C(=O)N[C@@H](CC(C)C)C(=O)N3C[C@H](N=[N+]=[N-])[C@H]4OCC(=O)[C@H]43)cc2)CC1 |
| InChI | InChI=1S/C27H38N6O4/c1-4-11-32-12-9-19(10-13-32)18-5-7-20(8-6-18)26(35)29-21(14-17(2)3)27(36)33-15-22(30-31-28)25-24(33)23(34)16-37-25/h5-8,17,19,21-22,24-25H,4,9-16H2,1-3H3,(H,29,35)/t21-,22-,24+,25+/m0/s1 |
| InChIKey | FYBOAEAFDKQAEU-ZCAIMPEWSA-N |
| XLogP | 3.28 |
| TPSA | 127.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.64 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|