C25H35N7O5 — CID 145477125
N-[1-(6-azido-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl)-3-methoxy-1-oxobutan-2-yl]-4-(4-propylpiperazin-1-yl)benzamide (PubChem CID 145477125) has the molecular formula C25H35N7O5 and a molecular weight of 513.60 g/mol. Its IUPAC name is N-[1-(6-azido-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl)-3-methoxy-1-oxobutan-2-yl]-4-(4-propylpiperazin-1-yl)benzamide.
| Compound Name | N-[1-(6-azido-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl)-3-methoxy-1-oxobutan-2-yl]-4-(4-propylpiperazin-1-yl)benzamide |
|---|---|
| PubChem CID | 145477125 |
| Molecular Formula | C25H35N7O5 |
| Molecular Weight | 513.60 g/mol |
| Exact Mass | 513.27 |
| IUPAC Name | N-[1-(6-azido-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl)-3-methoxy-1-oxobutan-2-yl]-4-(4-propylpiperazin-1-yl)benzamide |
| SMILES | CCCN1CCN(c2ccc(C(=O)NC(C(=O)N3CC(N=[N+]=[N-])C4OCC(=O)C43)C(C)OC)cc2)CC1 |
| InChI | InChI=1S/C25H35N7O5/c1-4-9-30-10-12-31(13-11-30)18-7-5-17(6-8-18)24(34)27-21(16(2)36-3)25(35)32-14-19(28-29-26)23-22(32)20(33)15-37-23/h5-8,16,19,21-23H,4,9-15H2,1-3H3,(H,27,34) |
| InChIKey | NNDQIJVQIYGZOD-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 140.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.60 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|