C26H37N7O4 — CID 141331389
N-[(2S)-1-[(3aS,6S,6aS)-6-azido-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-3,3-dimethyl-1-oxobutan-2-yl]-4-(4-propylpiperazin-1-yl)benzamide (PubChem CID 141331389) has the molecular formula C26H37N7O4 and a molecular weight of 511.63 g/mol. Its IUPAC name is N-[(2S)-1-[(3aS,6S,6aS)-6-azido-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-3,3-dimethyl-1-oxobutan-2-yl]-4-(4-propylpiperazin-1-yl)benzamide.
| Compound Name | N-[(2S)-1-[(3aS,6S,6aS)-6-azido-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-3,3-dimethyl-1-oxobutan-2-yl]-4-(4-propylpiperazin-1-yl)benzamide |
|---|---|
| PubChem CID | 141331389 |
| Molecular Formula | C26H37N7O4 |
| Molecular Weight | 511.63 g/mol |
| Exact Mass | 511.29 |
| IUPAC Name | N-[(2S)-1-[(3aS,6S,6aS)-6-azido-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-3,3-dimethyl-1-oxobutan-2-yl]-4-(4-propylpiperazin-1-yl)benzamide |
| SMILES | CCCN1CCN(c2ccc(C(=O)N[C@H](C(=O)N3C[C@H](N=[N+]=[N-])[C@H]4OCC(=O)[C@H]43)C(C)(C)C)cc2)CC1 |
| InChI | InChI=1S/C26H37N7O4/c1-5-10-31-11-13-32(14-12-31)18-8-6-17(7-9-18)24(35)28-23(26(2,3)4)25(36)33-15-19(29-30-27)22-21(33)20(34)16-37-22/h6-9,19,21-23H,5,10-16H2,1-4H3,(H,28,35)/t19-,21+,22+,23+/m0/s1 |
| InChIKey | UWFMUAGQYADMFT-MLDBQTBOSA-N |
| XLogP | 2.22 |
| TPSA | 130.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.63 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|