C22H47NO4S — CID 141332064
dimethyl-[(Z)-octadec-9-enyl]azanium;ethyl sulfate (PubChem CID 141332064) has the molecular formula C22H47NO4S and a molecular weight of 421.69 g/mol. Its IUPAC name is dimethyl-[(Z)-octadec-9-enyl]azanium;ethyl sulfate.
| Compound Name | dimethyl-[(Z)-octadec-9-enyl]azanium;ethyl sulfate |
|---|---|
| PubChem CID | 141332064 |
| Molecular Formula | C22H47NO4S |
| Molecular Weight | 421.69 g/mol |
| Exact Mass | 421.32 |
| IUPAC Name | dimethyl-[(Z)-octadec-9-enyl]azanium;ethyl sulfate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC[NH+](C)C.CCOS(=O)(=O)[O-] |
| InChI | InChI=1S/C20H41N.C2H6O4S/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21(2)3;1-2-6-7(3,4)5/h11-12H,4-10,13-20H2,1-3H3;2H2,1H3,(H,3,4,5)/b12-11-; |
| InChIKey | TXAKMQLKHUATNL-AFEZEDKISA-N |
| XLogP | 4.65 |
| TPSA | 70.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.69 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|