C16H23Cl2N3O2S — CID 141334118
N-[(2S)-1-(but-2-enylamino)propan-2-yl]isoquinoline-6-sulfonamide;dihydrochloride (PubChem CID 141334118) has the molecular formula C16H23Cl2N3O2S and a molecular weight of 392.35 g/mol. Its IUPAC name is N-[(2S)-1-(but-2-enylamino)propan-2-yl]isoquinoline-6-sulfonamide;dihydrochloride.
| Compound Name | N-[(2S)-1-(but-2-enylamino)propan-2-yl]isoquinoline-6-sulfonamide;dihydrochloride |
|---|---|
| PubChem CID | 141334118 |
| Molecular Formula | C16H23Cl2N3O2S |
| Molecular Weight | 392.35 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | N-[(2S)-1-(but-2-enylamino)propan-2-yl]isoquinoline-6-sulfonamide;dihydrochloride |
| SMILES | CC=CCNC[C@H](C)NS(=O)(=O)c1ccc2cnccc2c1.Cl.Cl |
| InChI | InChI=1S/C16H21N3O2S.2ClH/c1-3-4-8-17-11-13(2)19-22(20,21)16-6-5-15-12-18-9-7-14(15)10-16;;/h3-7,9-10,12-13,17,19H,8,11H2,1-2H3;2*1H/t13-;;/m0../s1 |
| InChIKey | HQJVUYSUXXPQOA-GXKRWWSZSA-N |
| XLogP | 2.91 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.35 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|