C14H21Cl2N3O2S — CID 57411489
N-[(2R)-1-(ethylamino)propan-2-yl]isoquinoline-6-sulfonamide;dihydrochloride (PubChem CID 57411489) has the molecular formula C14H21Cl2N3O2S and a molecular weight of 366.31 g/mol. Its IUPAC name is N-[(2R)-1-(ethylamino)propan-2-yl]isoquinoline-6-sulfonamide;dihydrochloride.
| Compound Name | N-[(2R)-1-(ethylamino)propan-2-yl]isoquinoline-6-sulfonamide;dihydrochloride |
|---|---|
| PubChem CID | 57411489 |
| Molecular Formula | C14H21Cl2N3O2S |
| Molecular Weight | 366.31 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | N-[(2R)-1-(ethylamino)propan-2-yl]isoquinoline-6-sulfonamide;dihydrochloride |
| SMILES | CCNC[C@@H](C)NS(=O)(=O)c1ccc2cnccc2c1.Cl.Cl |
| InChI | InChI=1S/C14H19N3O2S.2ClH/c1-3-15-9-11(2)17-20(18,19)14-5-4-13-10-16-7-6-12(13)8-14;;/h4-8,10-11,15,17H,3,9H2,1-2H3;2*1H/t11-;;/m1../s1 |
| InChIKey | JXPAXTGGWXRKEG-NVJADKKVSA-N |
| XLogP | 2.35 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.31 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |