C25H26N4O2S — CID 76527354
N-[1-[2-(4-pyridin-4-ylphenyl)ethylamino]propan-2-yl]isoquinoline-6-sulfonamide (PubChem CID 76527354) has the molecular formula C25H26N4O2S and a molecular weight of 446.58 g/mol. Its IUPAC name is N-[1-[2-(4-pyridin-4-ylphenyl)ethylamino]propan-2-yl]isoquinoline-6-sulfonamide.
| Compound Name | N-[1-[2-(4-pyridin-4-ylphenyl)ethylamino]propan-2-yl]isoquinoline-6-sulfonamide |
|---|---|
| PubChem CID | 76527354 |
| Molecular Formula | C25H26N4O2S |
| Molecular Weight | 446.58 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | N-[1-[2-(4-pyridin-4-ylphenyl)ethylamino]propan-2-yl]isoquinoline-6-sulfonamide |
| SMILES | CC(CNCCc1ccc(-c2ccncc2)cc1)NS(=O)(=O)c1ccc2cnccc2c1 |
| InChI | InChI=1S/C25H26N4O2S/c1-19(29-32(30,31)25-7-6-24-18-28-15-11-23(24)16-25)17-27-12-8-20-2-4-21(5-3-20)22-9-13-26-14-10-22/h2-7,9-11,13-16,18-19,27,29H,8,12,17H2,1H3 |
| InChIKey | HXPOAHORKQWLFT-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.58 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|