C22H25ClN6O3 — CID 141334727
N-[2-chloro-4-[(6-nitroquinazolin-2-yl)amino]phenyl]-2-(dipropylamino)acetamide (PubChem CID 141334727) has the molecular formula C22H25ClN6O3 and a molecular weight of 456.93 g/mol. Its IUPAC name is N-[2-chloro-4-[(6-nitroquinazolin-2-yl)amino]phenyl]-2-(dipropylamino)acetamide.
| Compound Name | N-[2-chloro-4-[(6-nitroquinazolin-2-yl)amino]phenyl]-2-(dipropylamino)acetamide |
|---|---|
| PubChem CID | 141334727 |
| Molecular Formula | C22H25ClN6O3 |
| Molecular Weight | 456.93 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | N-[2-chloro-4-[(6-nitroquinazolin-2-yl)amino]phenyl]-2-(dipropylamino)acetamide |
| SMILES | CCCN(CCC)CC(=O)Nc1ccc(Nc2ncc3cc([N+](=O)[O-])ccc3n2)cc1Cl |
| InChI | InChI=1S/C22H25ClN6O3/c1-3-9-28(10-4-2)14-21(30)26-20-7-5-16(12-18(20)23)25-22-24-13-15-11-17(29(31)32)6-8-19(15)27-22/h5-8,11-13H,3-4,9-10,14H2,1-2H3,(H,26,30)(H,24,25,27) |
| InChIKey | IODSEOWGFGRSES-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.93 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|