C12H8N4O3 — CID 141335946
4-(4-nitrophenyl)-1,7-dihydropyrazolo[5,4-b]pyridin-6-one (PubChem CID 141335946) has the molecular formula C12H8N4O3 and a molecular weight of 256.22 g/mol. Its IUPAC name is 4-(4-nitrophenyl)-1,7-dihydropyrazolo[5,4-b]pyridin-6-one.
| Compound Name | 4-(4-nitrophenyl)-1,7-dihydropyrazolo[5,4-b]pyridin-6-one |
|---|---|
| PubChem CID | 141335946 |
| Molecular Formula | C12H8N4O3 |
| Molecular Weight | 256.22 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | 4-(4-nitrophenyl)-1,7-dihydropyrazolo[5,4-b]pyridin-6-one |
| SMILES | O=c1cc(-c2ccc([N+](=O)[O-])cc2)c2cn[nH]c2[nH]1 |
| InChI | InChI=1S/C12H8N4O3/c17-11-5-9(10-6-13-15-12(10)14-11)7-1-3-8(4-2-7)16(18)19/h1-6H,(H2,13,14,15,17) |
| InChIKey | VCLGDHVXXSZVML-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 104.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.22 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|