About 4-(4-nitrophenyl)-1,7-dihydropyrazolo[5,4-b]pyridin-6-one
4-(4-nitrophenyl)-1,7-dihydropyrazolo[5,4-b]pyridin-6-one (PubChem CID 141335946) has the molecular formula C12H8N4O3
and a molecular weight of 256.22 g/mol. Its IUPAC name is 4-(4-nitrophenyl)-1,7-dihydropyrazolo[5,4-b]pyridin-6-one.
Molecular Properties
| Compound Name | 4-(4-nitrophenyl)-1,7-dihydropyrazolo[5,4-b]pyridin-6-one |
| PubChem CID | 141335946 |
| Molecular Formula | C12H8N4O3 |
| Molecular Weight | 256.22 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | 4-(4-nitrophenyl)-1,7-dihydropyrazolo[5,4-b]pyridin-6-one |
| SMILES | O=c1cc(-c2ccc([N+](=O)[O-])cc2)c2cn[nH]c2[nH]1 |
| InChI | InChI=1S/C12H8N4O3/c17-11-5-9(10-6-13-15-12(10)14-11)7-1-3-8(4-2-7)16(18)19/h1-6H,(H2,13,14,15,17) |
| InChIKey | VCLGDHVXXSZVML-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 104.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.22 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-nitrophenyl)-1,7-dihydropyrazolo[5,4-b]pyridin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-nitrophenyl)-1,7-dihydropyrazolo[5,4-b]pyridin-6-one?
The IUPAC name of 4-(4-nitrophenyl)-1,7-dihydropyrazolo[5,4-b]pyridin-6-one (CID 141335946) is 4-(4-nitrophenyl)-1,7-dihydropyrazolo[5,4-b]pyridin-6-one.
What is the SMILES notation for 4-(4-nitrophenyl)-1,7-dihydropyrazolo[5,4-b]pyridin-6-one?
The canonical SMILES for 4-(4-nitrophenyl)-1,7-dihydropyrazolo[5,4-b]pyridin-6-one is O=c1cc(-c2ccc([N+](=O)[O-])cc2)c2cn[nH]c2[nH]1.
What is the InChIKey of 4-(4-nitrophenyl)-1,7-dihydropyrazolo[5,4-b]pyridin-6-one?
The InChIKey is VCLGDHVXXSZVML-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N4O3/c17-11-5-9(10-6-13-15-12(10)14-11)7-1-3-8(4-2-7)16(18)19/h1-6H,(H2,13,14,15,17).
What are the key properties of 4-(4-nitrophenyl)-1,7-dihydropyrazolo[5,4-b]pyridin-6-one?
4-(4-nitrophenyl)-1,7-dihydropyrazolo[5,4-b]pyridin-6-one has a molecular weight of 256.22 g/mol, XLogP of 1.83, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-nitrophenyl)-1,7-dihydropyrazolo[5,4-b]pyridin-6-one is sourced from PubChem (CID 141335946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).