C16H17N5O2 — CID 67547857
N,N-dimethyl-1-[4-(4-nitrophenyl)-1H-pyrazolo[5,4-b]pyridin-6-yl]ethanamine (PubChem CID 67547857) has the molecular formula C16H17N5O2 and a molecular weight of 311.35 g/mol. Its IUPAC name is N,N-dimethyl-1-[4-(4-nitrophenyl)-1H-pyrazolo[5,4-b]pyridin-6-yl]ethanamine.
| Compound Name | N,N-dimethyl-1-[4-(4-nitrophenyl)-1H-pyrazolo[5,4-b]pyridin-6-yl]ethanamine |
|---|---|
| PubChem CID | 67547857 |
| Molecular Formula | C16H17N5O2 |
| Molecular Weight | 311.35 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | N,N-dimethyl-1-[4-(4-nitrophenyl)-1H-pyrazolo[5,4-b]pyridin-6-yl]ethanamine |
| SMILES | CC(c1cc(-c2ccc([N+](=O)[O-])cc2)c2cn[nH]c2n1)N(C)C |
| InChI | InChI=1S/C16H17N5O2/c1-10(20(2)3)15-8-13(14-9-17-19-16(14)18-15)11-4-6-12(7-5-11)21(22)23/h4-10H,1-3H3,(H,17,18,19) |
| InChIKey | BRTXQBFOTNPSBM-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 87.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.35 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|