C26H23Cl2NO3 — CID 141337846
4-[(6-chloro-3,4-dihydro-2H-chromen-7-yl)oxy]-N-[(Z)-4-(2-chlorophenyl)but-3-enyl]benzamide (PubChem CID 141337846) has the molecular formula C26H23Cl2NO3 and a molecular weight of 468.38 g/mol. Its IUPAC name is 4-[(6-chloro-3,4-dihydro-2H-chromen-7-yl)oxy]-N-[(Z)-4-(2-chlorophenyl)but-3-enyl]benzamide.
| Compound Name | 4-[(6-chloro-3,4-dihydro-2H-chromen-7-yl)oxy]-N-[(Z)-4-(2-chlorophenyl)but-3-enyl]benzamide |
|---|---|
| PubChem CID | 141337846 |
| Molecular Formula | C26H23Cl2NO3 |
| Molecular Weight | 468.38 g/mol |
| Exact Mass | 467.11 |
| IUPAC Name | 4-[(6-chloro-3,4-dihydro-2H-chromen-7-yl)oxy]-N-[(Z)-4-(2-chlorophenyl)but-3-enyl]benzamide |
| SMILES | O=C(NCC/C=C\c1ccccc1Cl)c1ccc(Oc2cc3c(cc2Cl)CCCO3)cc1 |
| InChI | InChI=1S/C26H23Cl2NO3/c27-22-9-2-1-6-18(22)7-3-4-14-29-26(30)19-10-12-21(13-11-19)32-25-17-24-20(16-23(25)28)8-5-15-31-24/h1-3,6-7,9-13,16-17H,4-5,8,14-15H2,(H,29,30)/b7-3- |
| InChIKey | UJTWGASPEHNFMV-CLTKARDFSA-N |
| XLogP | 6.94 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.38 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|