C25H52O7Si — CID 141339673
tributoxy-[1-[1-[(2,4-diethyl-1,3-dioxetan-2-yl)oxy]propoxy]butyl]silane (PubChem CID 141339673) has the molecular formula C25H52O7Si and a molecular weight of 492.77 g/mol. Its IUPAC name is tributoxy-[1-[1-[(2,4-diethyl-1,3-dioxetan-2-yl)oxy]propoxy]butyl]silane.
| Compound Name | tributoxy-[1-[1-[(2,4-diethyl-1,3-dioxetan-2-yl)oxy]propoxy]butyl]silane |
|---|---|
| PubChem CID | 141339673 |
| Molecular Formula | C25H52O7Si |
| Molecular Weight | 492.77 g/mol |
| Exact Mass | 492.35 |
| IUPAC Name | tributoxy-[1-[1-[(2,4-diethyl-1,3-dioxetan-2-yl)oxy]propoxy]butyl]silane |
| SMILES | CCCCO[Si](OCCCC)(OCCCC)C(CCC)OC(CC)OC1(CC)OC(CC)O1 |
| InChI | InChI=1S/C25H52O7Si/c1-8-15-19-26-33(27-20-16-9-2,28-21-17-10-3)24(18-11-4)29-22(12-5)30-25(14-7)31-23(13-6)32-25/h22-24H,8-21H2,1-7H3 |
| InChIKey | RDFCJJPRMTZVQC-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.77 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|