C15H32O7Si — CID 140967214
1-[1-[(2-ethyl-1,3-dioxan-2-yl)oxy]propoxy]propyl-trimethoxysilane (PubChem CID 140967214) has the molecular formula C15H32O7Si and a molecular weight of 352.50 g/mol. Its IUPAC name is 1-[1-[(2-ethyl-1,3-dioxan-2-yl)oxy]propoxy]propyl-trimethoxysilane.
| Compound Name | 1-[1-[(2-ethyl-1,3-dioxan-2-yl)oxy]propoxy]propyl-trimethoxysilane |
|---|---|
| PubChem CID | 140967214 |
| Molecular Formula | C15H32O7Si |
| Molecular Weight | 352.50 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | 1-[1-[(2-ethyl-1,3-dioxan-2-yl)oxy]propoxy]propyl-trimethoxysilane |
| SMILES | CCC(OC(CC)[Si](OC)(OC)OC)OC1(CC)OCCCO1 |
| InChI | InChI=1S/C15H32O7Si/c1-7-13(22-15(9-3)19-11-10-12-20-15)21-14(8-2)23(16-4,17-5)18-6/h13-14H,7-12H2,1-6H3 |
| InChIKey | QMEOUCUNKYMPBD-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.50 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|